About propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate
propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134994183) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 134994183 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCCOC(=O)N1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C11H19NO2/c1-4-7-14-11(13)12-6-5-9(2)10(3)8-12/h4-8H2,1-3H3 |
| InChIKey | CXUBLVPAAORAFP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 134994183) is propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate is CCCOC(=O)N1CCC(C)=C(C)C1.
What is the InChIKey of propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is CXUBLVPAAORAFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-7-14-11(13)12-6-5-9(2)10(3)8-12/h4-8H2,1-3H3.
What are the key properties of propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 197.28 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 134994183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).