About 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride
3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride (PubChem CID 13499428) has the molecular formula C9H11ClN2O
and a molecular weight of 198.65 g/mol. Its IUPAC name is 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| PubChem CID | 13499428 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| SMILES | Cl.NC1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C9H10N2O.ClH/c10-7-5-6-3-1-2-4-8(6)11-9(7)12;/h1-4,7H,5,10H2,(H,11,12);1H |
| InChIKey | OKOGJVZTZMRXRG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride?
The IUPAC name of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride (CID 13499428) is 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride.
What is the SMILES notation for 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride?
The canonical SMILES for 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride is Cl.NC1Cc2ccccc2NC1=O.
What is the InChIKey of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride?
The InChIKey is OKOGJVZTZMRXRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O.ClH/c10-7-5-6-3-1-2-4-8(6)11-9(7)12;/h1-4,7H,5,10H2,(H,11,12);1H.
What are the key properties of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride?
3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride has a molecular weight of 198.65 g/mol, XLogP of 0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride is sourced from PubChem (CID 13499428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).