About 3-(2,2-diethoxyethyl)-1,2-oxazole
3-(2,2-diethoxyethyl)-1,2-oxazole (PubChem CID 134994287) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 3-(2,2-diethoxyethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(2,2-diethoxyethyl)-1,2-oxazole |
| PubChem CID | 134994287 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3-(2,2-diethoxyethyl)-1,2-oxazole |
| SMILES | CCOC(Cc1ccon1)OCC |
| InChI | InChI=1S/C9H15NO3/c1-3-11-9(12-4-2)7-8-5-6-13-10-8/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | HZRLHCMXZBIHPE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-diethoxyethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-diethoxyethyl)-1,2-oxazole?
The IUPAC name of 3-(2,2-diethoxyethyl)-1,2-oxazole (CID 134994287) is 3-(2,2-diethoxyethyl)-1,2-oxazole.
What is the SMILES notation for 3-(2,2-diethoxyethyl)-1,2-oxazole?
The canonical SMILES for 3-(2,2-diethoxyethyl)-1,2-oxazole is CCOC(Cc1ccon1)OCC.
What is the InChIKey of 3-(2,2-diethoxyethyl)-1,2-oxazole?
The InChIKey is HZRLHCMXZBIHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-3-11-9(12-4-2)7-8-5-6-13-10-8/h5-6,9H,3-4,7H2,1-2H3.
What are the key properties of 3-(2,2-diethoxyethyl)-1,2-oxazole?
3-(2,2-diethoxyethyl)-1,2-oxazole has a molecular weight of 185.22 g/mol, XLogP of 1.62, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-diethoxyethyl)-1,2-oxazole is sourced from PubChem (CID 134994287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).