About 4-ethyl-3,3,7-trimethyloct-1-en-4-amine
4-ethyl-3,3,7-trimethyloct-1-en-4-amine (PubChem CID 134994339) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 4-ethyl-3,3,7-trimethyloct-1-en-4-amine.
Molecular Properties
| Compound Name | 4-ethyl-3,3,7-trimethyloct-1-en-4-amine |
| PubChem CID | 134994339 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 4-ethyl-3,3,7-trimethyloct-1-en-4-amine |
| SMILES | C=CC(C)(C)C(N)(CC)CCC(C)C |
| InChI | InChI=1S/C13H27N/c1-7-12(5,6)13(14,8-2)10-9-11(3)4/h7,11H,1,8-10,14H2,2-6H3 |
| InChIKey | RLCANVDZPAHHFS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-3,3,7-trimethyloct-1-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3,3,7-trimethyloct-1-en-4-amine?
The IUPAC name of 4-ethyl-3,3,7-trimethyloct-1-en-4-amine (CID 134994339) is 4-ethyl-3,3,7-trimethyloct-1-en-4-amine.
What is the SMILES notation for 4-ethyl-3,3,7-trimethyloct-1-en-4-amine?
The canonical SMILES for 4-ethyl-3,3,7-trimethyloct-1-en-4-amine is C=CC(C)(C)C(N)(CC)CCC(C)C.
What is the InChIKey of 4-ethyl-3,3,7-trimethyloct-1-en-4-amine?
The InChIKey is RLCANVDZPAHHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-7-12(5,6)13(14,8-2)10-9-11(3)4/h7,11H,1,8-10,14H2,2-6H3.
What are the key properties of 4-ethyl-3,3,7-trimethyloct-1-en-4-amine?
4-ethyl-3,3,7-trimethyloct-1-en-4-amine has a molecular weight of 197.37 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3,3,7-trimethyloct-1-en-4-amine is sourced from PubChem (CID 134994339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).