About (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine
(2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine (PubChem CID 134994376) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine.
Analyze (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine?
The IUPAC name of (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine (CID 134994376) is (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine.
What is the SMILES notation for (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine?
The canonical SMILES for (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine is CC[C@@H](CN(C)C)N(C)C.
What is the InChIKey of (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine?
The InChIKey is MDXHGUSIQTUIEV-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H20N2/c1-6-8(10(4)5)7-9(2)3/h8H,6-7H2,1-5H3/t8-/m0/s1.
What are the key properties of (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine?
(2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine has a molecular weight of 144.26 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-N,1-N,2-N,2-N-tetramethylbutane-1,2-diamine is sourced from PubChem (CID 134994376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).