C13H22N2O — CID 134994507
2-(benzylamino)oxy-N,N-diethylethanamine (PubChem CID 134994507) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(benzylamino)oxy-N,N-diethylethanamine.
| Compound Name | 2-(benzylamino)oxy-N,N-diethylethanamine |
|---|---|
| PubChem CID | 134994507 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-(benzylamino)oxy-N,N-diethylethanamine |
| SMILES | CCN(CC)CCONCc1ccccc1 |
| InChI | InChI=1S/C13H22N2O/c1-3-15(4-2)10-11-16-14-12-13-8-6-5-7-9-13/h5-9,14H,3-4,10-12H2,1-2H3 |
| InChIKey | XEGYHFREUIKQFC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|