About (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene
(1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene (PubChem CID 134994742) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene.
Molecular Properties
| Compound Name | (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene |
| PubChem CID | 134994742 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C#CCCCC1=C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H14/c1-2-3-4-5-11-8-10-6-7-12(11)9-10/h1,6-8,10,12H,3-5,9H2/t10-,12-/m1/s1 |
| InChIKey | NWAMSYZNLMTOTM-ZYHUDNBSSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene?
The IUPAC name of (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene (CID 134994742) is (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene.
What is the SMILES notation for (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene?
The canonical SMILES for (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene is C#CCCCC1=C[C@H]2C=C[C@@H]1C2.
What is the InChIKey of (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene?
The InChIKey is NWAMSYZNLMTOTM-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H14/c1-2-3-4-5-11-8-10-6-7-12(11)9-10/h1,6-8,10,12H,3-5,9H2/t10-,12-/m1/s1.
What are the key properties of (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene?
(1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene has a molecular weight of 158.24 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-2-pent-4-ynylbicyclo[2.2.1]hepta-2,5-diene is sourced from PubChem (CID 134994742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).