About 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol
3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol (PubChem CID 134994832) has the molecular formula C18H24ClO2P
and a molecular weight of 338.81 g/mol. Its IUPAC name is 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol |
| PubChem CID | 134994832 |
| Molecular Formula | C18H24ClO2P |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol |
| SMILES | OCCCP(Cl)(CCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24ClO2P/c19-22(15-7-13-20,16-8-14-21,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,20-21H,7-8,13-16H2 |
| InChIKey | LRXCTLSEXYFDDU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol?
The IUPAC name of 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol (CID 134994832) is 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol.
What is the SMILES notation for 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol?
The canonical SMILES for 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol is OCCCP(Cl)(CCCO)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol?
The InChIKey is LRXCTLSEXYFDDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClO2P/c19-22(15-7-13-20,16-8-14-21,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,20-21H,7-8,13-16H2.
What are the key properties of 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol?
3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol has a molecular weight of 338.81 g/mol, XLogP of 3.11, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro-(3-hydroxypropyl)-diphenyl-λ5-phosphanyl]propan-1-ol is sourced from PubChem (CID 134994832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).