About [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane
[(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane (PubChem CID 134994840) has the molecular formula C15H32SiSn2
and a molecular weight of 477.93 g/mol. Its IUPAC name is [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane |
| PubChem CID | 134994840 |
| Molecular Formula | C15H32SiSn2 |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane |
| SMILES | CC/C(=C(/C#C[Si](C)(C)C)[Sn](C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C9H14Si.6CH3.2Sn/c1-5-6-7-8-9-10(2,3)4;;;;;;;;/h5H2,1-4H3;6*1H3;; |
| InChIKey | DVONHNAPOLQPAW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane?
The IUPAC name of [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane (CID 134994840) is [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane.
What is the SMILES notation for [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane?
The canonical SMILES for [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane is CC/C(=C(/C#C[Si](C)(C)C)[Sn](C)(C)C)[Sn](C)(C)C.
What is the InChIKey of [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane?
The InChIKey is DVONHNAPOLQPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14Si.6CH3.2Sn/c1-5-6-7-8-9-10(2,3)4;;;;;;;;/h5H2,1-4H3;6*1H3;;.
What are the key properties of [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane?
[(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane has a molecular weight of 477.93 g/mol, XLogP of 5.33, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3,4-bis(trimethylstannyl)hex-3-en-1-ynyl]-trimethylsilane is sourced from PubChem (CID 134994840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).