About 1,1-dideuteriododec-1-en-5,11-diyne
1,1-dideuteriododec-1-en-5,11-diyne (PubChem CID 134994869) has the molecular formula C12H16
and a molecular weight of 162.27 g/mol. Its IUPAC name is 1,1-dideuteriododec-1-en-5,11-diyne.
Molecular Properties
| Compound Name | 1,1-dideuteriododec-1-en-5,11-diyne |
| PubChem CID | 134994869 |
| Molecular Formula | C12H16 |
| Molecular Weight | 162.27 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1,1-dideuteriododec-1-en-5,11-diyne |
| SMILES | [2H]C([2H])=CCCC#CCCCCC#C |
| InChI | InChI=1S/C12H16/c1-3-5-7-9-11-12-10-8-6-4-2/h1,4H,2,5-9,11H2/i2D2 |
| InChIKey | GZQNPOAEXIVHIZ-CBTSVUPCSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dideuteriododec-1-en-5,11-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dideuteriododec-1-en-5,11-diyne?
The IUPAC name of 1,1-dideuteriododec-1-en-5,11-diyne (CID 134994869) is 1,1-dideuteriododec-1-en-5,11-diyne.
What is the SMILES notation for 1,1-dideuteriododec-1-en-5,11-diyne?
The canonical SMILES for 1,1-dideuteriododec-1-en-5,11-diyne is [2H]C([2H])=CCCC#CCCCCC#C.
What is the InChIKey of 1,1-dideuteriododec-1-en-5,11-diyne?
The InChIKey is GZQNPOAEXIVHIZ-CBTSVUPCSA-N. The full InChI is InChI=1S/C12H16/c1-3-5-7-9-11-12-10-8-6-4-2/h1,4H,2,5-9,11H2/i2D2.
What are the key properties of 1,1-dideuteriododec-1-en-5,11-diyne?
1,1-dideuteriododec-1-en-5,11-diyne has a molecular weight of 162.27 g/mol, XLogP of 3.15, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dideuteriododec-1-en-5,11-diyne is sourced from PubChem (CID 134994869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).