About cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one
cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one (PubChem CID 134994951) has the molecular formula C6H8IN3O
and a molecular weight of 265.05 g/mol. Its IUPAC name is cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one |
| PubChem CID | 134994951 |
| Molecular Formula | C6H8IN3O |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one |
| SMILES | [N-]=[N+]=N[C@@H]1CCCC(=O)[C@H]1I |
| InChI | InChI=1S/C6H8IN3O/c7-6-4(9-10-8)2-1-3-5(6)11/h4,6H,1-3H2/t4-,6+/m1/s1 |
| InChIKey | HFDYKFNAQLIPKP-XINAWCOVSA-N |
| XLogP | 2.22 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one?
The IUPAC name of cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one (CID 134994951) is cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one.
What is the SMILES notation for cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one?
The canonical SMILES for cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one is [N-]=[N+]=N[C@@H]1CCCC(=O)[C@H]1I.
What is the InChIKey of cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one?
The InChIKey is HFDYKFNAQLIPKP-XINAWCOVSA-N. The full InChI is InChI=1S/C6H8IN3O/c7-6-4(9-10-8)2-1-3-5(6)11/h4,6H,1-3H2/t4-,6+/m1/s1.
What are the key properties of cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one?
cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one has a molecular weight of 265.05 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3R)-3-azido-2-iodocyclohexan-1-one is sourced from PubChem (CID 134994951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).