About 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene
7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene (PubChem CID 134994980) has the molecular formula C9H11IS2
and a molecular weight of 310.23 g/mol. Its IUPAC name is 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene |
| PubChem CID | 134994980 |
| Molecular Formula | C9H11IS2 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.93 |
| IUPAC Name | 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene |
| SMILES | CSC1=C(SC)C(I)C=CC=C1 |
| InChI | InChI=1S/C9H11IS2/c1-11-8-6-4-3-5-7(10)9(8)12-2/h3-7H,1-2H3 |
| InChIKey | ZGLCWGTWEKVYIJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene?
The IUPAC name of 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene (CID 134994980) is 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene.
What is the SMILES notation for 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene?
The canonical SMILES for 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene is CSC1=C(SC)C(I)C=CC=C1.
What is the InChIKey of 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene?
The InChIKey is ZGLCWGTWEKVYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IS2/c1-11-8-6-4-3-5-7(10)9(8)12-2/h3-7H,1-2H3.
What are the key properties of 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene?
7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene has a molecular weight of 310.23 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-1,2-bis(methylsulfanyl)cyclohepta-1,3,5-triene is sourced from PubChem (CID 134994980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).