About [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane
[(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane (PubChem CID 134995059) has the molecular formula C15H28Si
and a molecular weight of 236.47 g/mol. Its IUPAC name is [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane |
| PubChem CID | 134995059 |
| Molecular Formula | C15H28Si |
| Molecular Weight | 236.47 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane |
| SMILES | CC(C)=CCC[C@H](C)CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H28Si/c1-14(2)10-9-12-15(3)11-7-8-13-16(4,5)6/h10,15H,7,9,11-12H2,1-6H3/t15-/m1/s1 |
| InChIKey | MKEPDXBQCFZVCO-OAHLLOKOSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane?
The IUPAC name of [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane (CID 134995059) is [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane.
What is the SMILES notation for [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane?
The canonical SMILES for [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane is CC(C)=CCC[C@H](C)CCC#C[Si](C)(C)C.
What is the InChIKey of [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane?
The InChIKey is MKEPDXBQCFZVCO-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H28Si/c1-14(2)10-9-12-15(3)11-7-8-13-16(4,5)6/h10,15H,7,9,11-12H2,1-6H3/t15-/m1/s1.
What are the key properties of [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane?
[(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane has a molecular weight of 236.47 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane is sourced from PubChem (CID 134995059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).