About 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine
4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine (PubChem CID 134995222) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine.
Molecular Properties
| Compound Name | 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine |
| PubChem CID | 134995222 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine |
| SMILES | C=C1CCOC=CC1=C(CC)CC |
| InChI | InChI=1S/C12H18O/c1-4-11(5-2)12-7-9-13-8-6-10(12)3/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | KYAKUWUWNKKRBB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine?
The IUPAC name of 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine (CID 134995222) is 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine.
What is the SMILES notation for 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine?
The canonical SMILES for 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine is C=C1CCOC=CC1=C(CC)CC.
What is the InChIKey of 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine?
The InChIKey is KYAKUWUWNKKRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-4-11(5-2)12-7-9-13-8-6-10(12)3/h7,9H,3-6,8H2,1-2H3.
What are the key properties of 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine?
4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine has a molecular weight of 178.27 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-5-pentan-3-ylidene-2,3-dihydrooxepine is sourced from PubChem (CID 134995222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).