About 5-methyldeca-2,3,4-trien-1-ol
5-methyldeca-2,3,4-trien-1-ol (PubChem CID 134995227) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 5-methyldeca-2,3,4-trien-1-ol.
Molecular Properties
| Compound Name | 5-methyldeca-2,3,4-trien-1-ol |
| PubChem CID | 134995227 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 5-methyldeca-2,3,4-trien-1-ol |
| SMILES | CCCCCC(C)=C=C=CCO |
| InChI | InChI=1S/C11H18O/c1-3-4-5-8-11(2)9-6-7-10-12/h7,12H,3-5,8,10H2,1-2H3/b11-7+ |
| InChIKey | ORJDLCGBVRVOMS-YRNVUSSQSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyldeca-2,3,4-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyldeca-2,3,4-trien-1-ol?
The IUPAC name of 5-methyldeca-2,3,4-trien-1-ol (CID 134995227) is 5-methyldeca-2,3,4-trien-1-ol.
What is the SMILES notation for 5-methyldeca-2,3,4-trien-1-ol?
The canonical SMILES for 5-methyldeca-2,3,4-trien-1-ol is CCCCCC(C)=C=C=CCO.
What is the InChIKey of 5-methyldeca-2,3,4-trien-1-ol?
The InChIKey is ORJDLCGBVRVOMS-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H18O/c1-3-4-5-8-11(2)9-6-7-10-12/h7,12H,3-5,8,10H2,1-2H3/b11-7+.
What are the key properties of 5-methyldeca-2,3,4-trien-1-ol?
5-methyldeca-2,3,4-trien-1-ol has a molecular weight of 166.26 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyldeca-2,3,4-trien-1-ol is sourced from PubChem (CID 134995227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).