About 4-methylidene-1,2-dihydroindene
4-methylidene-1,2-dihydroindene (PubChem CID 134995238) has the molecular formula C10H10
and a molecular weight of 130.19 g/mol. Its IUPAC name is 4-methylidene-1,2-dihydroindene.
Molecular Properties
| Compound Name | 4-methylidene-1,2-dihydroindene |
| PubChem CID | 134995238 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 4-methylidene-1,2-dihydroindene |
| SMILES | C=c1cccc2c1=CCC2 |
| InChI | InChI=1S/C10H10/c1-8-4-2-5-9-6-3-7-10(8)9/h2,4-5,7H,1,3,6H2 |
| InChIKey | HBVPAKRGGWWXSU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methylidene-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-1,2-dihydroindene?
The IUPAC name of 4-methylidene-1,2-dihydroindene (CID 134995238) is 4-methylidene-1,2-dihydroindene.
What is the SMILES notation for 4-methylidene-1,2-dihydroindene?
The canonical SMILES for 4-methylidene-1,2-dihydroindene is C=c1cccc2c1=CCC2.
What is the InChIKey of 4-methylidene-1,2-dihydroindene?
The InChIKey is HBVPAKRGGWWXSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10/c1-8-4-2-5-9-6-3-7-10(8)9/h2,4-5,7H,1,3,6H2.
What are the key properties of 4-methylidene-1,2-dihydroindene?
4-methylidene-1,2-dihydroindene has a molecular weight of 130.19 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-1,2-dihydroindene is sourced from PubChem (CID 134995238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).