About 1-(2-methylpenta-2,3-dienyl)pyrrolidine
1-(2-methylpenta-2,3-dienyl)pyrrolidine (PubChem CID 134995262) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-(2-methylpenta-2,3-dienyl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(2-methylpenta-2,3-dienyl)pyrrolidine |
| PubChem CID | 134995262 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-(2-methylpenta-2,3-dienyl)pyrrolidine |
| SMILES | CC=C=C(C)CN1CCCC1 |
| InChI | InChI=1S/C10H17N/c1-3-6-10(2)9-11-7-4-5-8-11/h3H,4-5,7-9H2,1-2H3 |
| InChIKey | NBHQYVHOSGFDPC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-methylpenta-2,3-dienyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpenta-2,3-dienyl)pyrrolidine?
The IUPAC name of 1-(2-methylpenta-2,3-dienyl)pyrrolidine (CID 134995262) is 1-(2-methylpenta-2,3-dienyl)pyrrolidine.
What is the SMILES notation for 1-(2-methylpenta-2,3-dienyl)pyrrolidine?
The canonical SMILES for 1-(2-methylpenta-2,3-dienyl)pyrrolidine is CC=C=C(C)CN1CCCC1.
What is the InChIKey of 1-(2-methylpenta-2,3-dienyl)pyrrolidine?
The InChIKey is NBHQYVHOSGFDPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-3-6-10(2)9-11-7-4-5-8-11/h3H,4-5,7-9H2,1-2H3.
What are the key properties of 1-(2-methylpenta-2,3-dienyl)pyrrolidine?
1-(2-methylpenta-2,3-dienyl)pyrrolidine has a molecular weight of 151.25 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpenta-2,3-dienyl)pyrrolidine is sourced from PubChem (CID 134995262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).