About trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane
trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane (PubChem CID 134995327) has the molecular formula C17H24Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane |
| PubChem CID | 134995327 |
| Molecular Formula | C17H24Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane |
| SMILES | CCCCCCC#CC#C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H24Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2,3)4/h14-15H,5-9H2,1-4H3/b15-14+ |
| InChIKey | RIRUGYBTCXTVLG-CCEZHUSRSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane?
The IUPAC name of trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane (CID 134995327) is trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane.
What is the SMILES notation for trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane?
The canonical SMILES for trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane is CCCCCCC#CC#C/C=C/C#C[Si](C)(C)C.
What is the InChIKey of trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane?
The InChIKey is RIRUGYBTCXTVLG-CCEZHUSRSA-N. The full InChI is InChI=1S/C17H24Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2,3)4/h14-15H,5-9H2,1-4H3/b15-14+.
What are the key properties of trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane?
trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane has a molecular weight of 256.46 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E)-tetradec-3-en-1,5,7-triynyl]silane is sourced from PubChem (CID 134995327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).