C14H24N2 — CID 134995406
N,N'-ditert-butylhexa-2,4-diyne-1,6-diamine (PubChem CID 134995406) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N,N'-ditert-butylhexa-2,4-diyne-1,6-diamine.
| Compound Name | N,N'-ditert-butylhexa-2,4-diyne-1,6-diamine |
|---|---|
| PubChem CID | 134995406 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N,N'-ditert-butylhexa-2,4-diyne-1,6-diamine |
| SMILES | CC(C)(C)NCC#CC#CCNC(C)(C)C |
| InChI | InChI=1S/C14H24N2/c1-13(2,3)15-11-9-7-8-10-12-16-14(4,5)6/h15-16H,11-12H2,1-6H3 |
| InChIKey | BUVQLGJHBRQLRH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|