C15H29IO2Si — CID 134995449
tert-butyl-[(3R,4E,6E)-7-iodo-3-methoxy-6-methylhepta-4,6-dienoxy]-dimethylsilane (PubChem CID 134995449) has the molecular formula C15H29IO2Si and a molecular weight of 396.39 g/mol. Its IUPAC name is tert-butyl-[(3R,4E,6E)-7-iodo-3-methoxy-6-methylhepta-4,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4E,6E)-7-iodo-3-methoxy-6-methylhepta-4,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134995449 |
| Molecular Formula | C15H29IO2Si |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | tert-butyl-[(3R,4E,6E)-7-iodo-3-methoxy-6-methylhepta-4,6-dienoxy]-dimethylsilane |
| SMILES | CO[C@@H](/C=C/C(C)=C/I)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29IO2Si/c1-13(12-16)8-9-14(17-5)10-11-18-19(6,7)15(2,3)4/h8-9,12,14H,10-11H2,1-7H3/b9-8+,13-12+/t14-/m0/s1 |
| InChIKey | IKRRYWZKGILWMS-IMGXDTGXSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|