About 2-chloro-4-methoxyoctane
2-chloro-4-methoxyoctane (PubChem CID 134995516) has the molecular formula C9H19ClO
and a molecular weight of 178.70 g/mol. Its IUPAC name is 2-chloro-4-methoxyoctane.
Molecular Properties
| Compound Name | 2-chloro-4-methoxyoctane |
| PubChem CID | 134995516 |
| Molecular Formula | C9H19ClO |
| Molecular Weight | 178.70 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-chloro-4-methoxyoctane |
| SMILES | CCCCC(CC(C)Cl)OC |
| InChI | InChI=1S/C9H19ClO/c1-4-5-6-9(11-3)7-8(2)10/h8-9H,4-7H2,1-3H3 |
| InChIKey | PCDSUDYSCSCLSJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methoxyoctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methoxyoctane?
The IUPAC name of 2-chloro-4-methoxyoctane (CID 134995516) is 2-chloro-4-methoxyoctane.
What is the SMILES notation for 2-chloro-4-methoxyoctane?
The canonical SMILES for 2-chloro-4-methoxyoctane is CCCCC(CC(C)Cl)OC.
What is the InChIKey of 2-chloro-4-methoxyoctane?
The InChIKey is PCDSUDYSCSCLSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19ClO/c1-4-5-6-9(11-3)7-8(2)10/h8-9H,4-7H2,1-3H3.
What are the key properties of 2-chloro-4-methoxyoctane?
2-chloro-4-methoxyoctane has a molecular weight of 178.70 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methoxyoctane is sourced from PubChem (CID 134995516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).