C10H13BrO2 — CID 134995563
6-bromo-5-methyl-3,3a,4,5,6,8a-hexahydrocyclohepta[b]furan-2-one (PubChem CID 134995563) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is 6-bromo-5-methyl-3,3a,4,5,6,8a-hexahydrocyclohepta[b]furan-2-one.
| Compound Name | 6-bromo-5-methyl-3,3a,4,5,6,8a-hexahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 134995563 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 6-bromo-5-methyl-3,3a,4,5,6,8a-hexahydrocyclohepta[b]furan-2-one |
| SMILES | CC1CC2CC(=O)OC2C=CC1Br |
| InChI | InChI=1S/C10H13BrO2/c1-6-4-7-5-10(12)13-9(7)3-2-8(6)11/h2-3,6-9H,4-5H2,1H3 |
| InChIKey | WCXQFURSNRYKDP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|