C9H8O5 — CID 134995707
(1S,7R)-1-(hydroxymethyl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 134995707) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is (1S,7R)-1-(hydroxymethyl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,7R)-1-(hydroxymethyl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 134995707 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (1S,7R)-1-(hydroxymethyl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1OC(=O)C2C1[C@H]1C=C[C@]2(CO)O1 |
| InChI | InChI=1S/C9H8O5/c10-3-9-2-1-4(14-9)5-6(9)8(12)13-7(5)11/h1-2,4-6,10H,3H2/t4-,5?,6?,9-/m1/s1 |
| InChIKey | PYFVYGAQPZEHGW-KVWPOIPWSA-N |
| XLogP | -1.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|