About [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate
[(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate (PubChem CID 134995813) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate |
| PubChem CID | 134995813 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate |
| SMILES | CC(=O)O/C(C)=C/CC1OC1(C)C |
| InChI | InChI=1S/C10H16O3/c1-7(12-8(2)11)5-6-9-10(3,4)13-9/h5,9H,6H2,1-4H3/b7-5+ |
| InChIKey | XLRBMHNINBUCOL-FNORWQNLSA-N |
| XLogP | 2.02 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate?
The IUPAC name of [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate (CID 134995813) is [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate.
What is the SMILES notation for [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate?
The canonical SMILES for [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate is CC(=O)O/C(C)=C/CC1OC1(C)C.
What is the InChIKey of [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate?
The InChIKey is XLRBMHNINBUCOL-FNORWQNLSA-N. The full InChI is InChI=1S/C10H16O3/c1-7(12-8(2)11)5-6-9-10(3,4)13-9/h5,9H,6H2,1-4H3/b7-5+.
What are the key properties of [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate?
[(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate has a molecular weight of 184.23 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-(3,3-dimethyloxiran-2-yl)but-2-en-2-yl] acetate is sourced from PubChem (CID 134995813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).