C10H18O — CID 134996007
6-ethyl-2,4,6-trimethyl-2,3-dihydropyran (PubChem CID 134996007) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 6-ethyl-2,4,6-trimethyl-2,3-dihydropyran.
| Compound Name | 6-ethyl-2,4,6-trimethyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 134996007 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 6-ethyl-2,4,6-trimethyl-2,3-dihydropyran |
| SMILES | CCC1(C)C=C(C)CC(C)O1 |
| InChI | InChI=1S/C10H18O/c1-5-10(4)7-8(2)6-9(3)11-10/h7,9H,5-6H2,1-4H3 |
| InChIKey | OWMXQACVJQKSIZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|