C8H5Cl7 — CID 134996065
1,2,3,4,7,7-hexachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 134996065) has the molecular formula C8H5Cl7 and a molecular weight of 349.30 g/mol. Its IUPAC name is 1,2,3,4,7,7-hexachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,2,3,4,7,7-hexachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 134996065 |
| Molecular Formula | C8H5Cl7 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 345.82 |
| IUPAC Name | 1,2,3,4,7,7-hexachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | ClCC1CC2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C8H5Cl7/c9-2-3-1-6(12)4(10)5(11)7(3,13)8(6,14)15/h3H,1-2H2 |
| InChIKey | NEQZFZHYMHEMQO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|