About 2-methyl-3,3-dinitrohexane
2-methyl-3,3-dinitrohexane (PubChem CID 134996081) has the molecular formula C7H14N2O4
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-methyl-3,3-dinitrohexane.
Molecular Properties
| Compound Name | 2-methyl-3,3-dinitrohexane |
| PubChem CID | 134996081 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-methyl-3,3-dinitrohexane |
| SMILES | CCCC(C(C)C)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H14N2O4/c1-4-5-7(6(2)3,8(10)11)9(12)13/h6H,4-5H2,1-3H3 |
| InChIKey | JDJBOEPBSPJENW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,3-dinitrohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,3-dinitrohexane?
The IUPAC name of 2-methyl-3,3-dinitrohexane (CID 134996081) is 2-methyl-3,3-dinitrohexane.
What is the SMILES notation for 2-methyl-3,3-dinitrohexane?
The canonical SMILES for 2-methyl-3,3-dinitrohexane is CCCC(C(C)C)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-methyl-3,3-dinitrohexane?
The InChIKey is JDJBOEPBSPJENW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O4/c1-4-5-7(6(2)3,8(10)11)9(12)13/h6H,4-5H2,1-3H3.
What are the key properties of 2-methyl-3,3-dinitrohexane?
2-methyl-3,3-dinitrohexane has a molecular weight of 190.20 g/mol, XLogP of 1.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,3-dinitrohexane is sourced from PubChem (CID 134996081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).