About (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene
(Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene (PubChem CID 134996144) has the molecular formula C10H16BrF3O
and a molecular weight of 289.13 g/mol. Its IUPAC name is (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene.
Molecular Properties
| Compound Name | (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene |
| PubChem CID | 134996144 |
| Molecular Formula | C10H16BrF3O |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene |
| SMILES | CCCCC/C(Br)=C(/OCC)C(F)(F)F |
| InChI | InChI=1S/C10H16BrF3O/c1-3-5-6-7-8(11)9(15-4-2)10(12,13)14/h3-7H2,1-2H3/b9-8- |
| InChIKey | XDDRPIQTIKRUBF-HJWRWDBZSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene?
The IUPAC name of (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene (CID 134996144) is (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene.
What is the SMILES notation for (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene?
The canonical SMILES for (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene is CCCCC/C(Br)=C(/OCC)C(F)(F)F.
What is the InChIKey of (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene?
The InChIKey is XDDRPIQTIKRUBF-HJWRWDBZSA-N. The full InChI is InChI=1S/C10H16BrF3O/c1-3-5-6-7-8(11)9(15-4-2)10(12,13)14/h3-7H2,1-2H3/b9-8-.
What are the key properties of (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene?
(Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene has a molecular weight of 289.13 g/mol, XLogP of 4.77, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-bromo-2-ethoxy-1,1,1-trifluorooct-2-ene is sourced from PubChem (CID 134996144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).