C11H10ClF — CID 134996157
(1R,8R,9S,11R)-11-chloro-9-fluorotricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 134996157) has the molecular formula C11H10ClF and a molecular weight of 196.65 g/mol. Its IUPAC name is (1R,8R,9S,11R)-11-chloro-9-fluorotricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8R,9S,11R)-11-chloro-9-fluorotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 134996157 |
| Molecular Formula | C11H10ClF |
| Molecular Weight | 196.65 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (1R,8R,9S,11R)-11-chloro-9-fluorotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | F[C@H]1C[C@@H]2c3ccccc3[C@H]1[C@@H]2Cl |
| InChI | InChI=1S/C11H10ClF/c12-11-8-5-9(13)10(11)7-4-2-1-3-6(7)8/h1-4,8-11H,5H2/t8-,9+,10-,11-/m1/s1 |
| InChIKey | QNLBKLLLVSAORX-LMLFDSFASA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|