About bis(3,5-dibromophenyl)diazene
bis(3,5-dibromophenyl)diazene (PubChem CID 134996202) has the molecular formula C12H6Br4N2
and a molecular weight of 497.81 g/mol. Its IUPAC name is bis(3,5-dibromophenyl)diazene.
Molecular Properties
| Compound Name | bis(3,5-dibromophenyl)diazene |
| PubChem CID | 134996202 |
| Molecular Formula | C12H6Br4N2 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 493.73 |
| IUPAC Name | bis(3,5-dibromophenyl)diazene |
| SMILES | Brc1cc(Br)cc(/N=N/c2cc(Br)cc(Br)c2)c1 |
| InChI | InChI=1S/C12H6Br4N2/c13-7-1-8(14)4-11(3-7)17-18-12-5-9(15)2-10(16)6-12/h1-6H/b18-17+ |
| InChIKey | BNXMFNRPJQPSHW-ISLYRVAYSA-N |
| XLogP | 7.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(3,5-dibromophenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,5-dibromophenyl)diazene?
The IUPAC name of bis(3,5-dibromophenyl)diazene (CID 134996202) is bis(3,5-dibromophenyl)diazene.
What is the SMILES notation for bis(3,5-dibromophenyl)diazene?
The canonical SMILES for bis(3,5-dibromophenyl)diazene is Brc1cc(Br)cc(/N=N/c2cc(Br)cc(Br)c2)c1.
What is the InChIKey of bis(3,5-dibromophenyl)diazene?
The InChIKey is BNXMFNRPJQPSHW-ISLYRVAYSA-N. The full InChI is InChI=1S/C12H6Br4N2/c13-7-1-8(14)4-11(3-7)17-18-12-5-9(15)2-10(16)6-12/h1-6H/b18-17+.
What are the key properties of bis(3,5-dibromophenyl)diazene?
bis(3,5-dibromophenyl)diazene has a molecular weight of 497.81 g/mol, XLogP of 7.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,5-dibromophenyl)diazene is sourced from PubChem (CID 134996202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).