C8H8O3 — CID 134996809
methyl 2,6-dideuterio-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate (PubChem CID 134996809) has the molecular formula C8H8O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is methyl 2,6-dideuterio-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate.
| Compound Name | methyl 2,6-dideuterio-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 134996809 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | methyl 2,6-dideuterio-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
| SMILES | [2H]C1=CC=CC2([2H])OC12C(=O)OC |
| InChI | InChI=1S/C8H8O3/c1-10-7(9)8-5-3-2-4-6(8)11-8/h2-6H,1H3/i5D,6D |
| InChIKey | QABTZOKANJRUFL-KCZCTXNHSA-N |
| XLogP | 0.42 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|