About 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one
5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one (PubChem CID 134996827) has the molecular formula C18H11FN4O
and a molecular weight of 318.31 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one |
| PubChem CID | 134996827 |
| Molecular Formula | C18H11FN4O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one |
| SMILES | O=c1[nH]nc(-c2ccc(F)cc2)c2cnc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H11FN4O/c19-13-8-6-11(7-9-13)15-14-10-20-17(12-4-2-1-3-5-12)21-16(14)18(24)23-22-15/h1-10H,(H,23,24) |
| InChIKey | HVDSWFQBRPXRTK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one?
The IUPAC name of 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one (CID 134996827) is 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one.
What is the SMILES notation for 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one?
The canonical SMILES for 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one is O=c1[nH]nc(-c2ccc(F)cc2)c2cnc(-c3ccccc3)nc12.
What is the InChIKey of 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one?
The InChIKey is HVDSWFQBRPXRTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11FN4O/c19-13-8-6-11(7-9-13)15-14-10-20-17(12-4-2-1-3-5-12)21-16(14)18(24)23-22-15/h1-10H,(H,23,24).
What are the key properties of 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one?
5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one has a molecular weight of 318.31 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-2-phenyl-7H-pyrimido[4,5-d]pyridazin-8-one is sourced from PubChem (CID 134996827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).