About 2,2'-spirobi[1,3,2λ4-benzodithiatellurole]
2,2'-spirobi[1,3,2λ4-benzodithiatellurole] (PubChem CID 134996847) has the molecular formula C12H8S4Te
and a molecular weight of 408.06 g/mol. Its IUPAC name is 2,2'-spirobi[1,3,2λ4-benzodithiatellurole].
Molecular Properties
| Compound Name | 2,2'-spirobi[1,3,2λ4-benzodithiatellurole] |
| PubChem CID | 134996847 |
| Molecular Formula | C12H8S4Te |
| Molecular Weight | 408.06 g/mol |
| Exact Mass | 409.86 |
| IUPAC Name | 2,2'-spirobi[1,3,2λ4-benzodithiatellurole] |
| SMILES | c1ccc2c(c1)S[Te]1(S2)Sc2ccccc2S1 |
| InChI | InChI=1S/C12H8S4Te/c1-2-6-10-9(5-1)13-17(14-10)15-11-7-3-4-8-12(11)16-17/h1-8H |
| InChIKey | GWODSFKXCPMIBU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.06 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2'-spirobi[1,3,2λ4-benzodithiatellurole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'-spirobi[1,3,2λ4-benzodithiatellurole]?
The IUPAC name of 2,2'-spirobi[1,3,2λ4-benzodithiatellurole] (CID 134996847) is 2,2'-spirobi[1,3,2λ4-benzodithiatellurole].
What is the SMILES notation for 2,2'-spirobi[1,3,2λ4-benzodithiatellurole]?
The canonical SMILES for 2,2'-spirobi[1,3,2λ4-benzodithiatellurole] is c1ccc2c(c1)S[Te]1(S2)Sc2ccccc2S1.
What is the InChIKey of 2,2'-spirobi[1,3,2λ4-benzodithiatellurole]?
The InChIKey is GWODSFKXCPMIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S4Te/c1-2-6-10-9(5-1)13-17(14-10)15-11-7-3-4-8-12(11)16-17/h1-8H.
What are the key properties of 2,2'-spirobi[1,3,2λ4-benzodithiatellurole]?
2,2'-spirobi[1,3,2λ4-benzodithiatellurole] has a molecular weight of 408.06 g/mol, XLogP of 5.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'-spirobi[1,3,2λ4-benzodithiatellurole] is sourced from PubChem (CID 134996847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).