C24H30O4 — CID 134996880
diethyl (3bR,6aS,7R,7aR)-3-methyl-7-phenyl-1,2,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,5-dicarboxylate (PubChem CID 134996880) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is diethyl (3bR,6aS,7R,7aR)-3-methyl-7-phenyl-1,2,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,5-dicarboxylate.
| Compound Name | diethyl (3bR,6aS,7R,7aR)-3-methyl-7-phenyl-1,2,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,5-dicarboxylate |
|---|---|
| PubChem CID | 134996880 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | diethyl (3bR,6aS,7R,7aR)-3-methyl-7-phenyl-1,2,3b,4,6,6a,7,7a-octahydrocyclopenta[a]pentalene-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2[C@@H](c3ccccc3)[C@H]3CCC(C)=C3[C@@H]2C1 |
| InChI | InChI=1S/C24H30O4/c1-4-27-22(25)24(23(26)28-5-2)13-18-19(14-24)21(16-9-7-6-8-10-16)17-12-11-15(3)20(17)18/h6-10,17-19,21H,4-5,11-14H2,1-3H3/t17-,18+,19-,21-/m0/s1 |
| InChIKey | DXRHTBAWJVJPBT-JTJHWIPRSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|