About CID 134996969
CID 134996969 (PubChem CID 134996969) has the molecular formula C58H114HgO2Si6
and a molecular weight of 1212.65 g/mol.
Molecular Properties
| Compound Name | CID 134996969 |
| PubChem CID | 134996969 |
| Molecular Formula | C58H114HgO2Si6 |
| Molecular Weight | 1212.65 g/mol |
| Exact Mass | 1212.71 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C(C)C)(C(C)C)C(C)C.CC(C)[Si](C(C)C)(C(C)C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C(C)C)(C(C)C)C(C)C.[Hg] |
| InChI | InChI=1S/2C29H57OSi3.Hg/c2*1-19(2)32(20(3)4,21(5)6)31(33(22(7)8,23(9)10)24(11)12)28(30)29-16-25-13-26(17-29)15-27(14-25)18-29;/h2*19-27H,13-18H2,1-12H3; |
| InChIKey | AWHGRHNPRDFFJX-UHFFFAOYSA-N |
| XLogP | 18.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 67 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1212.65 |
| LogP ≤ 5 | 18.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134996969 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134996969?
The IUPAC name of CID 134996969 (CID 134996969) is not available.
What is the SMILES notation for CID 134996969?
The canonical SMILES for CID 134996969 is CC(C)[Si](C(C)C)(C(C)C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C(C)C)(C(C)C)C(C)C.CC(C)[Si](C(C)C)(C(C)C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C(C)C)(C(C)C)C(C)C.[Hg].
What is the InChIKey of CID 134996969?
The InChIKey is AWHGRHNPRDFFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C29H57OSi3.Hg/c2*1-19(2)32(20(3)4,21(5)6)31(33(22(7)8,23(9)10)24(11)12)28(30)29-16-25-13-26(17-29)15-27(14-25)18-29;/h2*19-27H,13-18H2,1-12H3;.
What are the key properties of CID 134996969?
CID 134996969 has a molecular weight of 1212.65 g/mol, XLogP of 18.64, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134996969 is sourced from PubChem (CID 134996969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).