About CID 134996971
CID 134996971 (PubChem CID 134996971) has the molecular formula C46H90HgO2Si6
and a molecular weight of 1044.33 g/mol.
Molecular Properties
| Compound Name | CID 134996971 |
| PubChem CID | 134996971 |
| Molecular Formula | C46H90HgO2Si6 |
| Molecular Weight | 1044.33 g/mol |
| Exact Mass | 1044.53 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C)(C)C(C)(C)C.CC(C)(C)[Si](C)(C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C)(C)C(C)(C)C.[Hg] |
| InChI | InChI=1S/2C23H45OSi3.Hg/c2*1-21(2,3)26(7,8)25(27(9,10)22(4,5)6)20(24)23-14-17-11-18(15-23)13-19(12-17)16-23;/h2*17-19H,11-16H2,1-10H3; |
| InChIKey | FKCRUBHJNDQJRY-UHFFFAOYSA-N |
| XLogP | 13.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1044.33 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134996971 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134996971?
The IUPAC name of CID 134996971 (CID 134996971) is not available.
What is the SMILES notation for CID 134996971?
The canonical SMILES for CID 134996971 is CC(C)(C)[Si](C)(C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C)(C)C(C)(C)C.CC(C)(C)[Si](C)(C)[Si](C(=O)C12CC3CC(CC(C3)C1)C2)[Si](C)(C)C(C)(C)C.[Hg].
What is the InChIKey of CID 134996971?
The InChIKey is FKCRUBHJNDQJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C23H45OSi3.Hg/c2*1-21(2,3)26(7,8)25(27(9,10)22(4,5)6)20(24)23-14-17-11-18(15-23)13-19(12-17)16-23;/h2*17-19H,11-16H2,1-10H3;.
What are the key properties of CID 134996971?
CID 134996971 has a molecular weight of 1044.33 g/mol, XLogP of 13.96, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134996971 is sourced from PubChem (CID 134996971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).