C16H22O2 — CID 134997118
(3S,3aS)-4,5-dimethoxy-3-methyl-2,3,3a,6,7,8-hexahydro-1H-phenalene (PubChem CID 134997118) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3S,3aS)-4,5-dimethoxy-3-methyl-2,3,3a,6,7,8-hexahydro-1H-phenalene.
| Compound Name | (3S,3aS)-4,5-dimethoxy-3-methyl-2,3,3a,6,7,8-hexahydro-1H-phenalene |
|---|---|
| PubChem CID | 134997118 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (3S,3aS)-4,5-dimethoxy-3-methyl-2,3,3a,6,7,8-hexahydro-1H-phenalene |
| SMILES | COC1=C(OC)[C@@H]2C3=C(CCC=C3CC[C@@H]2C)C1 |
| InChI | InChI=1S/C16H22O2/c1-10-7-8-11-5-4-6-12-9-13(17-2)16(18-3)14(10)15(11)12/h5,10,14H,4,6-9H2,1-3H3/t10-,14-/m0/s1 |
| InChIKey | RNVYGPURVBUDDM-HZMBPMFUSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |