About ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate
ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate (PubChem CID 134997222) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate |
| PubChem CID | 134997222 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate |
| SMILES | CCOC(=O)CCc1ncc(C)o1 |
| InChI | InChI=1S/C9H13NO3/c1-3-12-9(11)5-4-8-10-6-7(2)13-8/h6H,3-5H2,1-2H3 |
| InChIKey | ZPYZARROQZHECA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate?
The IUPAC name of ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate (CID 134997222) is ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate.
What is the SMILES notation for ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate?
The canonical SMILES for ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate is CCOC(=O)CCc1ncc(C)o1.
What is the InChIKey of ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate?
The InChIKey is ZPYZARROQZHECA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-3-12-9(11)5-4-8-10-6-7(2)13-8/h6H,3-5H2,1-2H3.
What are the key properties of ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate?
ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate has a molecular weight of 183.21 g/mol, XLogP of 1.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(5-methyl-1,3-oxazol-2-yl)propanoate is sourced from PubChem (CID 134997222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).