C19H25NO7 — CID 134997264
2-O-tert-butyl 4-O-methyl (3S,4R,5S)-5-(2-methoxy-2-oxoethyl)-3-phenyl-1,2-oxazolidine-2,4-dicarboxylate (PubChem CID 134997264) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl (3S,4R,5S)-5-(2-methoxy-2-oxoethyl)-3-phenyl-1,2-oxazolidine-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-methyl (3S,4R,5S)-5-(2-methoxy-2-oxoethyl)-3-phenyl-1,2-oxazolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134997264 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl (3S,4R,5S)-5-(2-methoxy-2-oxoethyl)-3-phenyl-1,2-oxazolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C[C@@H]1ON(C(=O)OC(C)(C)C)[C@H](c2ccccc2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H25NO7/c1-19(2,3)26-18(23)20-16(12-9-7-6-8-10-12)15(17(22)25-5)13(27-20)11-14(21)24-4/h6-10,13,15-16H,11H2,1-5H3/t13-,15-,16+/m0/s1 |
| InChIKey | ZOVXXCLQGMTNLX-CWRNSKLLSA-N |
| XLogP | 2.63 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|