C17H28OSi — CID 134997266
[5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,5-dihydrofuran-2-yl]methyl-trimethylsilane (PubChem CID 134997266) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is [5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,5-dihydrofuran-2-yl]methyl-trimethylsilane.
| Compound Name | [5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,5-dihydrofuran-2-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 134997266 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [5-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,5-dihydrofuran-2-yl]methyl-trimethylsilane |
| SMILES | CC1(C)[C@H]2CC=C(C3C=CC(C[Si](C)(C)C)O3)[C@@H]1C2 |
| InChI | InChI=1S/C17H28OSi/c1-17(2)12-6-8-14(15(17)10-12)16-9-7-13(18-16)11-19(3,4)5/h7-9,12-13,15-16H,6,10-11H2,1-5H3/t12-,13?,15-,16?/m0/s1 |
| InChIKey | AGNBUBSRIKQUAJ-JMVNKWJPSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|