C19H21FOSi — CID 134997413
(1R,1aR,6R,6aS)-6-(4-fluorophenyl)-1-trimethylsilyl-1a,6a-dihydro-1H-cyclopropa[a]inden-6-ol (PubChem CID 134997413) has the molecular formula C19H21FOSi and a molecular weight of 312.46 g/mol. Its IUPAC name is (1R,1aR,6R,6aS)-6-(4-fluorophenyl)-1-trimethylsilyl-1a,6a-dihydro-1H-cyclopropa[a]inden-6-ol.
| Compound Name | (1R,1aR,6R,6aS)-6-(4-fluorophenyl)-1-trimethylsilyl-1a,6a-dihydro-1H-cyclopropa[a]inden-6-ol |
|---|---|
| PubChem CID | 134997413 |
| Molecular Formula | C19H21FOSi |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (1R,1aR,6R,6aS)-6-(4-fluorophenyl)-1-trimethylsilyl-1a,6a-dihydro-1H-cyclopropa[a]inden-6-ol |
| SMILES | C[Si](C)(C)[C@@H]1[C@H]2c3ccccc3[C@](O)(c3ccc(F)cc3)[C@H]21 |
| InChI | InChI=1S/C19H21FOSi/c1-22(2,3)18-16-14-6-4-5-7-15(14)19(21,17(16)18)12-8-10-13(20)11-9-12/h4-11,16-18,21H,1-3H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | NZOIYNLDCPCHAQ-WJFTUGDTSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|