C16H30O2Si — CID 134997417
1-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]-3-trimethylsilylpropan-2-one (PubChem CID 134997417) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is 1-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]-3-trimethylsilylpropan-2-one.
| Compound Name | 1-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]-3-trimethylsilylpropan-2-one |
|---|---|
| PubChem CID | 134997417 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]-3-trimethylsilylpropan-2-one |
| SMILES | C[C@@H]1C(OCC(=O)C[Si](C)(C)C)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-11-14-7-12(16(14,2)3)8-15(11)18-9-13(17)10-19(4,5)6/h11-12,14-15H,7-10H2,1-6H3/t11-,12+,14-,15?/m0/s1 |
| InChIKey | XSJIXOAZTYBFRE-PEZGSVAQSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|