C32H55NO3Sn — CID 134997446
[(1R,2R)-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134997446) has the molecular formula C32H55NO3Sn and a molecular weight of 620.51 g/mol. Its IUPAC name is [(1R,2R)-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2R)-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134997446 |
| Molecular Formula | C32H55NO3Sn |
| Molecular Weight | 620.51 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | [(1R,2R)-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H](c1ccccc1)[C@@H]1CCC[C@H]1OC(=O)N1C(C)(C)COC1(C)C |
| InChI | InChI=1S/C20H28NO3.3C4H9.Sn/c1-19(2)14-23-20(3,4)21(19)18(22)24-17-12-8-11-16(17)13-15-9-6-5-7-10-15;3*1-3-4-2;/h5-7,9-10,13,16-17H,8,11-12,14H2,1-4H3;3*1,3-4H2,2H3;/t16-,17+;;;;/m0..../s1 |
| InChIKey | DKUMOPKHRFWFEF-OKRZSZEPSA-N |
| XLogP | 9.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.51 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |