C34H40O6Si — CID 134997533
methyl (2E)-2-[(3R,4R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-1,10-dioxaspiro[4.5]decan-2-ylidene]acetate (PubChem CID 134997533) has the molecular formula C34H40O6Si and a molecular weight of 572.77 g/mol. Its IUPAC name is methyl (2E)-2-[(3R,4R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-1,10-dioxaspiro[4.5]decan-2-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(3R,4R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-1,10-dioxaspiro[4.5]decan-2-ylidene]acetate |
|---|---|
| PubChem CID | 134997533 |
| Molecular Formula | C34H40O6Si |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | methyl (2E)-2-[(3R,4R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-1,10-dioxaspiro[4.5]decan-2-ylidene]acetate |
| SMILES | COC(=O)/C=C1/OC2(CCCCO2)[C@H](OCc2ccccc2)[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H40O6Si/c1-33(2,3)41(27-18-10-6-11-19-27,28-20-12-7-13-21-28)40-31-29(24-30(35)36-4)39-34(22-14-15-23-38-34)32(31)37-25-26-16-8-5-9-17-26/h5-13,16-21,24,31-32H,14-15,22-23,25H2,1-4H3/b29-24-/t31-,32+,34?/m0/s1 |
| InChIKey | TXGRYHGJXUBYLD-JGWYFZILSA-N |
| XLogP | 5.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|