About platinum(2+);bis(trifluoromethylbenzene)
platinum(2+);bis(trifluoromethylbenzene) (PubChem CID 13499755) has the molecular formula C14H8F6Pt
and a molecular weight of 485.28 g/mol. Its IUPAC name is platinum(2+);bis(trifluoromethylbenzene).
Molecular Properties
| Compound Name | platinum(2+);bis(trifluoromethylbenzene) |
| PubChem CID | 13499755 |
| Molecular Formula | C14H8F6Pt |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | platinum(2+);bis(trifluoromethylbenzene) |
| SMILES | FC(F)(F)c1cc[c-]cc1.FC(F)(F)c1cc[c-]cc1.[Pt+2] |
| InChI | InChI=1S/2C7H4F3.Pt/c2*8-7(9,10)6-4-2-1-3-5-6;/h2*2-5H;/q2*-1;+2 |
| InChIKey | LBJGJDUSSCEVSB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze platinum(2+);bis(trifluoromethylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum(2+);bis(trifluoromethylbenzene)?
The IUPAC name of platinum(2+);bis(trifluoromethylbenzene) (CID 13499755) is platinum(2+);bis(trifluoromethylbenzene).
What is the SMILES notation for platinum(2+);bis(trifluoromethylbenzene)?
The canonical SMILES for platinum(2+);bis(trifluoromethylbenzene) is FC(F)(F)c1cc[c-]cc1.FC(F)(F)c1cc[c-]cc1.[Pt+2].
What is the InChIKey of platinum(2+);bis(trifluoromethylbenzene)?
The InChIKey is LBJGJDUSSCEVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H4F3.Pt/c2*8-7(9,10)6-4-2-1-3-5-6;/h2*2-5H;/q2*-1;+2.
What are the key properties of platinum(2+);bis(trifluoromethylbenzene)?
platinum(2+);bis(trifluoromethylbenzene) has a molecular weight of 485.28 g/mol, XLogP of 5.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for platinum(2+);bis(trifluoromethylbenzene) is sourced from PubChem (CID 13499755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).