C27H35NO2 — CID 134997553
(1S,8R,15R)-8-[(2-methoxyphenyl)methyl]-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene (PubChem CID 134997553) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is (1S,8R,15R)-8-[(2-methoxyphenyl)methyl]-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene.
| Compound Name | (1S,8R,15R)-8-[(2-methoxyphenyl)methyl]-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 134997553 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (1S,8R,15R)-8-[(2-methoxyphenyl)methyl]-11,11,15-trimethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
| SMILES | COc1ccccc1C[C@H]1CN2[C@@H](OC3C[C@H](C)CCC3C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C27H35NO2/c1-18-13-14-23-25(15-18)30-26-22-11-7-6-10-21(22)20(17-28(26)27(23,2)3)16-19-9-5-8-12-24(19)29-4/h5-12,18,20,23,25-26H,13-17H2,1-4H3/t18-,20+,23?,25?,26+/m1/s1 |
| InChIKey | IONVDEYRESKMJS-PCIUEVNCSA-N |
| XLogP | 5.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |