C15H16FNO2S — CID 134997590
(NZ)-N-(4-fluoro-3,4-dimethylcyclohexa-2,5-dien-1-ylidene)-4-methylbenzenesulfonamide (PubChem CID 134997590) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is (NZ)-N-(4-fluoro-3,4-dimethylcyclohexa-2,5-dien-1-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-(4-fluoro-3,4-dimethylcyclohexa-2,5-dien-1-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134997590 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (NZ)-N-(4-fluoro-3,4-dimethylcyclohexa-2,5-dien-1-ylidene)-4-methylbenzenesulfonamide |
| SMILES | CC1=C/C(=N\S(=O)(=O)c2ccc(C)cc2)C=CC1(C)F |
| InChI | InChI=1S/C15H16FNO2S/c1-11-4-6-14(7-5-11)20(18,19)17-13-8-9-15(3,16)12(2)10-13/h4-10H,1-3H3/b17-13- |
| InChIKey | KRRFOICEQIVLSN-LGMDPLHJSA-N |
| XLogP | 3.37 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|