C21H38N2O6 — CID 134997619
[(2S,4R)-4-(2,2,4,4-tetramethyl-1,3-oxazolidine-3-carbonyl)oxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134997619) has the molecular formula C21H38N2O6 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(2S,4R)-4-(2,2,4,4-tetramethyl-1,3-oxazolidine-3-carbonyl)oxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(2S,4R)-4-(2,2,4,4-tetramethyl-1,3-oxazolidine-3-carbonyl)oxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134997619 |
| Molecular Formula | C21H38N2O6 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | [(2S,4R)-4-(2,2,4,4-tetramethyl-1,3-oxazolidine-3-carbonyl)oxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H](C[C@H](C)OC(=O)N1C(C)(C)COC1(C)C)OC(=O)N1C(C)(C)COC1(C)C |
| InChI | InChI=1S/C21H38N2O6/c1-14(28-16(24)22-18(3,4)12-26-20(22,7)8)11-15(2)29-17(25)23-19(5,6)13-27-21(23,9)10/h14-15H,11-13H2,1-10H3/t14-,15+ |
| InChIKey | MSQNWLKMTFDKKS-GASCZTMLSA-N |
| XLogP | 4.12 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |