C47H54O13S — CID 134997659
[3,5-diacetyloxy-6-methylsulfanyl-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 134997659) has the molecular formula C47H54O13S and a molecular weight of 859.00 g/mol. Its IUPAC name is [3,5-diacetyloxy-6-methylsulfanyl-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-6-methylsulfanyl-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134997659 |
| Molecular Formula | C47H54O13S |
| Molecular Weight | 859.00 g/mol |
| Exact Mass | 858.33 |
| IUPAC Name | [3,5-diacetyloxy-6-methylsulfanyl-4-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CSC1OC(COC(C)=O)C(OC(C)=O)C(OC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C47H54O13S/c1-31(48)52-30-39-41(56-32(2)49)43(45(57-33(3)50)47(59-39)61-4)60-46-44(55-28-37-23-15-8-16-24-37)42(54-27-36-21-13-7-14-22-36)40(53-26-35-19-11-6-12-20-35)38(58-46)29-51-25-34-17-9-5-10-18-34/h5-24,38-47H,25-30H2,1-4H3 |
| InChIKey | KWJSQIOFSGHTRT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.00 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|