About 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol
1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol (PubChem CID 134997668) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol |
| PubChem CID | 134997668 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CCCCCCCCCC[C@H]1O[C@@H]1C(O)C(C)(C)C |
| InChI | InChI=1S/C17H34O2/c1-5-6-7-8-9-10-11-12-13-14-15(19-14)16(18)17(2,3)4/h14-16,18H,5-13H2,1-4H3/t14-,15+,16?/m1/s1 |
| InChIKey | SJOSVIYLWOIZDQ-YSPPHNQVSA-N |
| XLogP | 4.69 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol?
The IUPAC name of 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol (CID 134997668) is 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol is CCCCCCCCCC[C@H]1O[C@@H]1C(O)C(C)(C)C.
What is the InChIKey of 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol?
The InChIKey is SJOSVIYLWOIZDQ-YSPPHNQVSA-N. The full InChI is InChI=1S/C17H34O2/c1-5-6-7-8-9-10-11-12-13-14-15(19-14)16(18)17(2,3)4/h14-16,18H,5-13H2,1-4H3/t14-,15+,16?/m1/s1.
What are the key properties of 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol?
1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol has a molecular weight of 270.46 g/mol, XLogP of 4.69, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,3R)-3-decyloxiran-2-yl]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 134997668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).